C11H18O — CID 14805481
(2R,4S)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxane (PubChem CID 14805481) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (2R,4S)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxane.
| Compound Name | (2R,4S)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxane |
|---|---|
| PubChem CID | 14805481 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (2R,4S)-4-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]oxane |
| SMILES | C=C(C)/C=C/[C@H]1C[C@@H](C)CCO1 |
| InChI | InChI=1S/C11H18O/c1-9(2)4-5-11-8-10(3)6-7-12-11/h4-5,10-11H,1,6-8H2,2-3H3/b5-4+/t10-,11-/m0/s1 |
| InChIKey | WGYHJPVUEIFTRI-NNOMMRTBSA-N |
| XLogP | 2.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|