C16H12Cl2N2O2S2 — CID 1480810
4-(2,3-dichloro-4-ethylsulfonylphenyl)-2-pyridin-4-yl-1,3-thiazole (PubChem CID 1480810) has the molecular formula C16H12Cl2N2O2S2 and a molecular weight of 399.32 g/mol. Its IUPAC name is 4-(2,3-dichloro-4-ethylsulfonylphenyl)-2-pyridin-4-yl-1,3-thiazole.
| Compound Name | 4-(2,3-dichloro-4-ethylsulfonylphenyl)-2-pyridin-4-yl-1,3-thiazole |
|---|---|
| PubChem CID | 1480810 |
| Molecular Formula | C16H12Cl2N2O2S2 |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | 4-(2,3-dichloro-4-ethylsulfonylphenyl)-2-pyridin-4-yl-1,3-thiazole |
| SMILES | CCS(=O)(=O)c1ccc(-c2csc(-c3ccncc3)n2)c(Cl)c1Cl |
| InChI | InChI=1S/C16H12Cl2N2O2S2/c1-2-24(21,22)13-4-3-11(14(17)15(13)18)12-9-23-16(20-12)10-5-7-19-8-6-10/h3-9H,2H2,1H3 |
| InChIKey | STMRTBZTCVSJLB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |