C12H9F3N2S — CID 1481113
2-(3,4,4-trifluorobut-3-enylsulfanyl)quinoxaline (PubChem CID 1481113) has the molecular formula C12H9F3N2S and a molecular weight of 270.28 g/mol. Its IUPAC name is 2-(3,4,4-trifluorobut-3-enylsulfanyl)quinoxaline.
| Compound Name | 2-(3,4,4-trifluorobut-3-enylsulfanyl)quinoxaline |
|---|---|
| PubChem CID | 1481113 |
| Molecular Formula | C12H9F3N2S |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 2-(3,4,4-trifluorobut-3-enylsulfanyl)quinoxaline |
| SMILES | FC(F)=C(F)CCSc1cnc2ccccc2n1 |
| InChI | InChI=1S/C12H9F3N2S/c13-8(12(14)15)5-6-18-11-7-16-9-3-1-2-4-10(9)17-11/h1-4,7H,5-6H2 |
| InChIKey | MWBIKIRCCXZIPE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |