C9H8F3NS — CID 154269112
4-(3,4,4-trifluorobut-3-enylsulfanyl)pyridine (PubChem CID 154269112) has the molecular formula C9H8F3NS and a molecular weight of 219.23 g/mol. Its IUPAC name is 4-(3,4,4-trifluorobut-3-enylsulfanyl)pyridine.
| Compound Name | 4-(3,4,4-trifluorobut-3-enylsulfanyl)pyridine |
|---|---|
| PubChem CID | 154269112 |
| Molecular Formula | C9H8F3NS |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 4-(3,4,4-trifluorobut-3-enylsulfanyl)pyridine |
| SMILES | FC(F)=C(F)CCSc1ccncc1 |
| InChI | InChI=1S/C9H8F3NS/c10-8(9(11)12)3-6-14-7-1-4-13-5-2-7/h1-2,4-5H,3,6H2 |
| InChIKey | WSVVPNALFYWAPY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |