About 4-(3-pyridin-4-ylsulfanylpropylsulfanyl)pyridine;dihydrofluoride
4-(3-pyridin-4-ylsulfanylpropylsulfanyl)pyridine;dihydrofluoride (PubChem CID 159237641) has the molecular formula C13H16F2N2S2
and a molecular weight of 302.41 g/mol. Its IUPAC name is 4-(3-pyridin-4-ylsulfanylpropylsulfanyl)pyridine;dihydrofluoride.
Molecular Properties
| Compound Name | 4-(3-pyridin-4-ylsulfanylpropylsulfanyl)pyridine;dihydrofluoride |
| PubChem CID | 159237641 |
| Molecular Formula | C13H16F2N2S2 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 4-(3-pyridin-4-ylsulfanylpropylsulfanyl)pyridine;dihydrofluoride |
| SMILES | F.F.c1cc(SCCCSc2ccncc2)ccn1 |
| InChI | InChI=1S/C13H14N2S2.2FH/c1(10-16-12-2-6-14-7-3-12)11-17-13-4-8-15-9-5-13;;/h2-9H,1,10-11H2;2*1H |
| InChIKey | KTRNCFHLJVYFDE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-pyridin-4-ylsulfanylpropylsulfanyl)pyridine;dihydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-pyridin-4-ylsulfanylpropylsulfanyl)pyridine;dihydrofluoride?
The IUPAC name of 4-(3-pyridin-4-ylsulfanylpropylsulfanyl)pyridine;dihydrofluoride (CID 159237641) is 4-(3-pyridin-4-ylsulfanylpropylsulfanyl)pyridine;dihydrofluoride.
What is the SMILES notation for 4-(3-pyridin-4-ylsulfanylpropylsulfanyl)pyridine;dihydrofluoride?
The canonical SMILES for 4-(3-pyridin-4-ylsulfanylpropylsulfanyl)pyridine;dihydrofluoride is F.F.c1cc(SCCCSc2ccncc2)ccn1.
What is the InChIKey of 4-(3-pyridin-4-ylsulfanylpropylsulfanyl)pyridine;dihydrofluoride?
The InChIKey is KTRNCFHLJVYFDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2S2.2FH/c1(10-16-12-2-6-14-7-3-12)11-17-13-4-8-15-9-5-13;;/h2-9H,1,10-11H2;2*1H.
What are the key properties of 4-(3-pyridin-4-ylsulfanylpropylsulfanyl)pyridine;dihydrofluoride?
4-(3-pyridin-4-ylsulfanylpropylsulfanyl)pyridine;dihydrofluoride has a molecular weight of 302.41 g/mol, XLogP of 4.06, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-pyridin-4-ylsulfanylpropylsulfanyl)pyridine;dihydrofluoride is sourced from PubChem (CID 159237641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).