C13H27NO — CID 14811818
1,2,2,3,3,4,6,6-octamethylpiperidin-4-ol (PubChem CID 14811818) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is 1,2,2,3,3,4,6,6-octamethylpiperidin-4-ol.
| Compound Name | 1,2,2,3,3,4,6,6-octamethylpiperidin-4-ol |
|---|---|
| PubChem CID | 14811818 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 1,2,2,3,3,4,6,6-octamethylpiperidin-4-ol |
| SMILES | CN1C(C)(C)CC(C)(O)C(C)(C)C1(C)C |
| InChI | InChI=1S/C13H27NO/c1-10(2)9-13(7,15)11(3,4)12(5,6)14(10)8/h15H,9H2,1-8H3 |
| InChIKey | CIDFGSPQSDUTAJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |