C14H26F3NO — CID 153289723
1,2-ditert-butyl-4-(trifluoromethyl)piperidin-4-ol (PubChem CID 153289723) has the molecular formula C14H26F3NO and a molecular weight of 281.36 g/mol. Its IUPAC name is 1,2-ditert-butyl-4-(trifluoromethyl)piperidin-4-ol.
| Compound Name | 1,2-ditert-butyl-4-(trifluoromethyl)piperidin-4-ol |
|---|---|
| PubChem CID | 153289723 |
| Molecular Formula | C14H26F3NO |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 1,2-ditert-butyl-4-(trifluoromethyl)piperidin-4-ol |
| SMILES | CC(C)(C)C1CC(O)(C(F)(F)F)CCN1C(C)(C)C |
| InChI | InChI=1S/C14H26F3NO/c1-11(2,3)10-9-13(19,14(15,16)17)7-8-18(10)12(4,5)6/h10,19H,7-9H2,1-6H3 |
| InChIKey | SEVJITYITXOARR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |