C24H24BNO2 — CID 14814047
(3aS)-1-(4-methoxyphenyl)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole (PubChem CID 14814047) has the molecular formula C24H24BNO2 and a molecular weight of 369.27 g/mol. Its IUPAC name is (3aS)-1-(4-methoxyphenyl)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole.
| Compound Name | (3aS)-1-(4-methoxyphenyl)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole |
|---|---|
| PubChem CID | 14814047 |
| Molecular Formula | C24H24BNO2 |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (3aS)-1-(4-methoxyphenyl)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole |
| SMILES | COc1ccc(B2OC(c3ccccc3)(c3ccccc3)[C@@H]3CCCN23)cc1 |
| InChI | InChI=1S/C24H24BNO2/c1-27-22-16-14-21(15-17-22)25-26-18-8-13-23(26)24(28-25,19-9-4-2-5-10-19)20-11-6-3-7-12-20/h2-7,9-12,14-17,23H,8,13,18H2,1H3/t23-/m0/s1 |
| InChIKey | YNHSTUDFLARYQP-QHCPKHFHSA-N |
| XLogP | 3.83 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|