C30H33BF6N2O6S2 — CID 135082747
(3aS)-3,3-bis(3,5-dimethylphenyl)-1-(2-methoxyphenyl)-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 135082747) has the molecular formula C30H33BF6N2O6S2 and a molecular weight of 706.54 g/mol. Its IUPAC name is (3aS)-3,3-bis(3,5-dimethylphenyl)-1-(2-methoxyphenyl)-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | (3aS)-3,3-bis(3,5-dimethylphenyl)-1-(2-methoxyphenyl)-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 135082747 |
| Molecular Formula | C30H33BF6N2O6S2 |
| Molecular Weight | 706.54 g/mol |
| Exact Mass | 706.18 |
| IUPAC Name | (3aS)-3,3-bis(3,5-dimethylphenyl)-1-(2-methoxyphenyl)-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole;1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | COc1ccccc1B1OC(c2cc(C)cc(C)c2)(c2cc(C)cc(C)c2)[C@@H]2CCCN12.O=S(=O)(NS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C28H32BNO2.C2HF6NO4S2/c1-19-13-20(2)16-23(15-19)28(24-17-21(3)14-22(4)18-24)27-11-8-12-30(27)29(32-28)25-9-6-7-10-26(25)31-5;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h6-7,9-10,13-18,27H,8,11-12H2,1-5H3;9H/t27-;/m0./s1 |
| InChIKey | JPDCOINTRNFUTE-YCBFMBTMSA-N |
| XLogP | 5.34 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.54 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|