C27H27BF6N2O5S2 — CID 72707686
(3aS)-1-(2,4-dimethylphenyl)-3,3-diphenyl-4,5,6,7-tetrahydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborol-7-ium;bis(trifluoromethylsulfonyl)azanide (PubChem CID 72707686) has the molecular formula C27H27BF6N2O5S2 and a molecular weight of 648.46 g/mol. Its IUPAC name is (3aS)-1-(2,4-dimethylphenyl)-3,3-diphenyl-4,5,6,7-tetrahydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborol-7-ium;bis(trifluoromethylsulfonyl)azanide.
| Compound Name | (3aS)-1-(2,4-dimethylphenyl)-3,3-diphenyl-4,5,6,7-tetrahydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborol-7-ium;bis(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 72707686 |
| Molecular Formula | C27H27BF6N2O5S2 |
| Molecular Weight | 648.46 g/mol |
| Exact Mass | 648.14 |
| IUPAC Name | (3aS)-1-(2,4-dimethylphenyl)-3,3-diphenyl-4,5,6,7-tetrahydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborol-7-ium;bis(trifluoromethylsulfonyl)azanide |
| SMILES | Cc1ccc(B2OC(c3ccccc3)(c3ccccc3)[C@@H]3CCC[NH+]23)c(C)c1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C25H26BNO.C2F6NO4S2/c1-19-15-16-23(20(2)18-19)26-27-17-9-14-24(27)25(28-26,21-10-5-3-6-11-21)22-12-7-4-8-13-22;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-8,10-13,15-16,18,24H,9,14,17H2,1-2H3;/q;-1/p+1/t24-;/m0./s1 |
| InChIKey | XXHDOABHFHVTSD-JIDHJSLPSA-O |
| XLogP | 4.08 |
| TPSA | 96.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|