C27H27BF6N2O5S2 — CID 25033766
(3aS,7R)-7-methyl-1-(2-methylphenyl)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborol-7-ium;bis(trifluoromethylsulfonyl)azanide (PubChem CID 25033766) has the molecular formula C27H27BF6N2O5S2 and a molecular weight of 648.46 g/mol. Its IUPAC name is (3aS,7R)-7-methyl-1-(2-methylphenyl)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborol-7-ium;bis(trifluoromethylsulfonyl)azanide.
| Compound Name | (3aS,7R)-7-methyl-1-(2-methylphenyl)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborol-7-ium;bis(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 25033766 |
| Molecular Formula | C27H27BF6N2O5S2 |
| Molecular Weight | 648.46 g/mol |
| Exact Mass | 648.14 |
| IUPAC Name | (3aS,7R)-7-methyl-1-(2-methylphenyl)-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborol-7-ium;bis(trifluoromethylsulfonyl)azanide |
| SMILES | Cc1ccccc1B1OC(c2ccccc2)(c2ccccc2)[C@@H]2CCC[N@+]12C.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C25H27BNO.C2F6NO4S2/c1-20-12-9-10-17-23(20)26-27(2)19-11-18-24(27)25(28-26,21-13-5-3-6-14-21)22-15-7-4-8-16-22;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-10,12-17,24H,11,18-19H2,1-2H3;/q+1;-1/t24-,27-;/m0./s1 |
| InChIKey | PDKCJUZNBLYUNU-GAOQVRBLSA-N |
| XLogP | 5.33 |
| TPSA | 91.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|