C16H10Cl2N2OS — CID 1482538
(2-anilino-1,3-thiazol-5-yl)-(3,4-dichlorophenyl)methanone (PubChem CID 1482538) has the molecular formula C16H10Cl2N2OS and a molecular weight of 349.24 g/mol. Its IUPAC name is (2-anilino-1,3-thiazol-5-yl)-(3,4-dichlorophenyl)methanone.
| Compound Name | (2-anilino-1,3-thiazol-5-yl)-(3,4-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 1482538 |
| Molecular Formula | C16H10Cl2N2OS |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | (2-anilino-1,3-thiazol-5-yl)-(3,4-dichlorophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)c1cnc(Nc2ccccc2)s1 |
| InChI | InChI=1S/C16H10Cl2N2OS/c17-12-7-6-10(8-13(12)18)15(21)14-9-19-16(22-14)20-11-4-2-1-3-5-11/h1-9H,(H,19,20) |
| InChIKey | SVEZLFIDJBZDOE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |