C20H29NO3 — CID 14827595
tert-butyl 2,2-dimethyl-4-[(E)-4-phenylbut-1-enyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 14827595) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is tert-butyl 2,2-dimethyl-4-[(E)-4-phenylbut-1-enyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl 2,2-dimethyl-4-[(E)-4-phenylbut-1-enyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 14827595 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | tert-butyl 2,2-dimethyl-4-[(E)-4-phenylbut-1-enyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(/C=C/CCc2ccccc2)COC1(C)C |
| InChI | InChI=1S/C20H29NO3/c1-19(2,3)24-18(22)21-17(15-23-20(21,4)5)14-10-9-13-16-11-7-6-8-12-16/h6-8,10-12,14,17H,9,13,15H2,1-5H3/b14-10+ |
| InChIKey | FPIYYSDHQPPSKF-GXDHUFHOSA-N |
| XLogP | 4.55 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|