C44H56N4O8 — CID 14827676
N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-2-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethanamine (PubChem CID 14827676) has the molecular formula C44H56N4O8 and a molecular weight of 768.95 g/mol. Its IUPAC name is N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-2-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethanamine.
| Compound Name | N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-2-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethanamine |
|---|---|
| PubChem CID | 14827676 |
| Molecular Formula | C44H56N4O8 |
| Molecular Weight | 768.95 g/mol |
| Exact Mass | 768.41 |
| IUPAC Name | N-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-2-[(2R,3R,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]ethanamine |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCNCC[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C44H56N4O8/c45-48-47-24-26-50-28-30-51-29-27-49-25-23-46-22-21-40-42(53-32-37-15-7-2-8-16-37)44(55-34-39-19-11-4-12-20-39)43(54-33-38-17-9-3-10-18-38)41(56-40)35-52-31-36-13-5-1-6-14-36/h1-20,40-44,46H,21-35H2/t40-,41-,42-,43-,44-/m1/s1 |
| InChIKey | GRUMIMMRWFOUNK-HQZUZMDCSA-N |
| XLogP | 7.07 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.95 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|