C34H35NO4S — CID 10896951
(3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine-2-thione (PubChem CID 10896951) has the molecular formula C34H35NO4S and a molecular weight of 553.72 g/mol. Its IUPAC name is (3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine-2-thione.
| Compound Name | (3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine-2-thione |
|---|---|
| PubChem CID | 10896951 |
| Molecular Formula | C34H35NO4S |
| Molecular Weight | 553.72 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | (3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)piperidine-2-thione |
| SMILES | S=C1N[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H35NO4S/c40-34-33(39-24-29-19-11-4-12-20-29)32(38-23-28-17-9-3-10-18-28)31(37-22-27-15-7-2-8-16-27)30(35-34)25-36-21-26-13-5-1-6-14-26/h1-20,30-33H,21-25H2,(H,35,40)/t30-,31-,32+,33-/m1/s1 |
| InChIKey | PCPZQSDXDXNPSK-NXVJRICRSA-N |
| XLogP | 6.26 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.72 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|