C10H15BrO2 — CID 14832122
(2R,3S,6S)-3-bromo-2-methyl-1,7-dioxaspiro[5.5]undec-4-ene (PubChem CID 14832122) has the molecular formula C10H15BrO2 and a molecular weight of 247.13 g/mol. Its IUPAC name is (2R,3S,6S)-3-bromo-2-methyl-1,7-dioxaspiro[5.5]undec-4-ene.
| Compound Name | (2R,3S,6S)-3-bromo-2-methyl-1,7-dioxaspiro[5.5]undec-4-ene |
|---|---|
| PubChem CID | 14832122 |
| Molecular Formula | C10H15BrO2 |
| Molecular Weight | 247.13 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | (2R,3S,6S)-3-bromo-2-methyl-1,7-dioxaspiro[5.5]undec-4-ene |
| SMILES | C[C@H]1O[C@]2(C=C[C@@H]1Br)CCCCO2 |
| InChI | InChI=1S/C10H15BrO2/c1-8-9(11)4-6-10(13-8)5-2-3-7-12-10/h4,6,8-9H,2-3,5,7H2,1H3/t8-,9+,10+/m1/s1 |
| InChIKey | CGUHDRZHXDBQHU-UTLUCORTSA-N |
| XLogP | 2.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.13 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|