C11H17BrO2 — CID 14832124
(3R,6S)-3-bromo-2,2-dimethyl-1,7-dioxaspiro[5.5]undec-4-ene (PubChem CID 14832124) has the molecular formula C11H17BrO2 and a molecular weight of 261.16 g/mol. Its IUPAC name is (3R,6S)-3-bromo-2,2-dimethyl-1,7-dioxaspiro[5.5]undec-4-ene.
| Compound Name | (3R,6S)-3-bromo-2,2-dimethyl-1,7-dioxaspiro[5.5]undec-4-ene |
|---|---|
| PubChem CID | 14832124 |
| Molecular Formula | C11H17BrO2 |
| Molecular Weight | 261.16 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | (3R,6S)-3-bromo-2,2-dimethyl-1,7-dioxaspiro[5.5]undec-4-ene |
| SMILES | CC1(C)O[C@]2(C=C[C@H]1Br)CCCCO2 |
| InChI | InChI=1S/C11H17BrO2/c1-10(2)9(12)5-7-11(14-10)6-3-4-8-13-11/h5,7,9H,3-4,6,8H2,1-2H3/t9-,11+/m1/s1 |
| InChIKey | UEBYMZZUPYKDGC-KOLCDFICSA-N |
| XLogP | 3.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.16 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|