C22H20O9 — CID 14832179
[(1R,2R,4S)-2-ethyl-2,4,5,7,12-pentahydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-1-yl] acetate (PubChem CID 14832179) has the molecular formula C22H20O9 and a molecular weight of 428.39 g/mol. Its IUPAC name is [(1R,2R,4S)-2-ethyl-2,4,5,7,12-pentahydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-1-yl] acetate.
| Compound Name | [(1R,2R,4S)-2-ethyl-2,4,5,7,12-pentahydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-1-yl] acetate |
|---|---|
| PubChem CID | 14832179 |
| Molecular Formula | C22H20O9 |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | [(1R,2R,4S)-2-ethyl-2,4,5,7,12-pentahydroxy-6,11-dioxo-3,4-dihydro-1H-tetracen-1-yl] acetate |
| SMILES | CC[C@@]1(O)C[C@H](O)c2c(O)c3c(c(O)c2[C@H]1OC(C)=O)C(=O)c1cccc(O)c1C3=O |
| InChI | InChI=1S/C22H20O9/c1-3-22(30)7-11(25)13-16(21(22)31-8(2)23)20(29)14-15(19(13)28)18(27)12-9(17(14)26)5-4-6-10(12)24/h4-6,11,21,24-25,28-30H,3,7H2,1-2H3/t11-,21+,22+/m0/s1 |
| InChIKey | JOAURUSBOAUEED-TUIGOVRASA-N |
| XLogP | 1.76 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|