C33H34O16 — CID 90671925
methyl (1R,2R,4S)-2-ethyl-2,5,7,12-tetrahydroxy-6,11-dioxo-4-[(2S,3R,4S,5S)-3,4,5-triacetyloxyoxan-2-yl]oxy-3,4-dihydro-1H-tetracene-1-carboxylate (PubChem CID 90671925) has the molecular formula C33H34O16 and a molecular weight of 686.62 g/mol. Its IUPAC name is methyl (1R,2R,4S)-2-ethyl-2,5,7,12-tetrahydroxy-6,11-dioxo-4-[(2S,3R,4S,5S)-3,4,5-triacetyloxyoxan-2-yl]oxy-3,4-dihydro-1H-tetracene-1-carboxylate.
| Compound Name | methyl (1R,2R,4S)-2-ethyl-2,5,7,12-tetrahydroxy-6,11-dioxo-4-[(2S,3R,4S,5S)-3,4,5-triacetyloxyoxan-2-yl]oxy-3,4-dihydro-1H-tetracene-1-carboxylate |
|---|---|
| PubChem CID | 90671925 |
| Molecular Formula | C33H34O16 |
| Molecular Weight | 686.62 g/mol |
| Exact Mass | 686.18 |
| IUPAC Name | methyl (1R,2R,4S)-2-ethyl-2,5,7,12-tetrahydroxy-6,11-dioxo-4-[(2S,3R,4S,5S)-3,4,5-triacetyloxyoxan-2-yl]oxy-3,4-dihydro-1H-tetracene-1-carboxylate |
| SMILES | CC[C@@]1(O)C[C@H](O[C@@H]2OC[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)c2c(O)c3c(c(O)c2[C@H]1C(=O)OC)C(=O)c1cccc(O)c1C3=O |
| InChI | InChI=1S/C33H34O16/c1-6-33(43)10-17(49-32-30(48-14(4)36)29(47-13(3)35)18(11-45-32)46-12(2)34)20-21(24(33)31(42)44-5)28(41)22-23(27(20)40)26(39)19-15(25(22)38)8-7-9-16(19)37/h7-9,17-18,24,29-30,32,37,40-41,43H,6,10-11H2,1-5H3/t17-,18-,24-,29-,30+,32-,33+/m0/s1 |
| InChIKey | YBFCBAAUFCCODU-VQAAOHHQSA-N |
| XLogP | 1.59 |
| TPSA | 238.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.62 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|