C24H22N2O4S — CID 148501353
2,3-bis(4-methoxyphenyl)-6-(methylsulfonylmethyl)quinoxaline (PubChem CID 148501353) has the molecular formula C24H22N2O4S and a molecular weight of 434.52 g/mol. Its IUPAC name is 2,3-bis(4-methoxyphenyl)-6-(methylsulfonylmethyl)quinoxaline.
| Compound Name | 2,3-bis(4-methoxyphenyl)-6-(methylsulfonylmethyl)quinoxaline |
|---|---|
| PubChem CID | 148501353 |
| Molecular Formula | C24H22N2O4S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 2,3-bis(4-methoxyphenyl)-6-(methylsulfonylmethyl)quinoxaline |
| SMILES | COc1ccc(-c2nc3ccc(CS(C)(=O)=O)cc3nc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H22N2O4S/c1-29-19-9-5-17(6-10-19)23-24(18-7-11-20(30-2)12-8-18)26-22-14-16(15-31(3,27)28)4-13-21(22)25-23/h4-14H,15H2,1-3H3 |
| InChIKey | MKSCVEHQXMCSOF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |