C32H40FN3O3 — CID 148525248
N-[1-(4-acetylcyclohexyl)-6-[[4-(2-hydroxypropan-2-yl)piperidin-1-yl]methyl]-3H-indol-2-ylidene]-3-fluorobenzamide (PubChem CID 148525248) has the molecular formula C32H40FN3O3 and a molecular weight of 533.69 g/mol. Its IUPAC name is N-[1-(4-acetylcyclohexyl)-6-[[4-(2-hydroxypropan-2-yl)piperidin-1-yl]methyl]-3H-indol-2-ylidene]-3-fluorobenzamide.
| Compound Name | N-[1-(4-acetylcyclohexyl)-6-[[4-(2-hydroxypropan-2-yl)piperidin-1-yl]methyl]-3H-indol-2-ylidene]-3-fluorobenzamide |
|---|---|
| PubChem CID | 148525248 |
| Molecular Formula | C32H40FN3O3 |
| Molecular Weight | 533.69 g/mol |
| Exact Mass | 533.31 |
| IUPAC Name | N-[1-(4-acetylcyclohexyl)-6-[[4-(2-hydroxypropan-2-yl)piperidin-1-yl]methyl]-3H-indol-2-ylidene]-3-fluorobenzamide |
| SMILES | CC(=O)C1CCC(N2/C(=N/C(=O)c3cccc(F)c3)Cc3ccc(CN4CCC(C(C)(C)O)CC4)cc32)CC1 |
| InChI | InChI=1S/C32H40FN3O3/c1-21(37)23-9-11-28(12-10-23)36-29-17-22(20-35-15-13-26(14-16-35)32(2,3)39)7-8-24(29)19-30(36)34-31(38)25-5-4-6-27(33)18-25/h4-8,17-18,23,26,28,39H,9-16,19-20H2,1-3H3/b34-30+ |
| InChIKey | MPEXZPAHCGGQBX-VBMGMRCRSA-N |
| XLogP | 5.56 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.69 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|