C26H32N4O5S — CID 148532143
(4aR,8aS)-6-[4-[(3-methylsulfonylphenyl)-pyridin-4-ylmethyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one (PubChem CID 148532143) has the molecular formula C26H32N4O5S and a molecular weight of 512.63 g/mol. Its IUPAC name is (4aR,8aS)-6-[4-[(3-methylsulfonylphenyl)-pyridin-4-ylmethyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one.
| Compound Name | (4aR,8aS)-6-[4-[(3-methylsulfonylphenyl)-pyridin-4-ylmethyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 148532143 |
| Molecular Formula | C26H32N4O5S |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | (4aR,8aS)-6-[4-[(3-methylsulfonylphenyl)-pyridin-4-ylmethyl]piperidine-1-carbonyl]-4,4a,5,7,8,8a-hexahydropyrido[4,3-b][1,4]oxazin-3-one |
| SMILES | CS(=O)(=O)c1cccc(C(c2ccncc2)C2CCN(C(=O)N3CC[C@@H]4OCC(=O)N[C@@H]4C3)CC2)c1 |
| InChI | InChI=1S/C26H32N4O5S/c1-36(33,34)21-4-2-3-20(15-21)25(18-5-10-27-11-6-18)19-7-12-29(13-8-19)26(32)30-14-9-23-22(16-30)28-24(31)17-35-23/h2-6,10-11,15,19,22-23,25H,7-9,12-14,16-17H2,1H3,(H,28,31)/t22-,23+,25?/m1/s1 |
| InChIKey | MQMQCHUNKXZSPJ-QRKINALSSA-N |
| XLogP | 2.04 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |