C11H14N3O+ — CID 148541074
3,4-dimethyl-2-[(2-methyl-3-pyridinyl)methyl]-1,2,5-oxadiazol-2-ium (PubChem CID 148541074) has the molecular formula C11H14N3O+ and a molecular weight of 204.25 g/mol. Its IUPAC name is 3,4-dimethyl-2-[(2-methyl-3-pyridinyl)methyl]-1,2,5-oxadiazol-2-ium.
| Compound Name | 3,4-dimethyl-2-[(2-methyl-3-pyridinyl)methyl]-1,2,5-oxadiazol-2-ium |
|---|---|
| PubChem CID | 148541074 |
| Molecular Formula | C11H14N3O+ |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 3,4-dimethyl-2-[(2-methyl-3-pyridinyl)methyl]-1,2,5-oxadiazol-2-ium |
| SMILES | Cc1ncccc1C[n+]1onc(C)c1C |
| InChI | InChI=1S/C11H14N3O/c1-8-10(3)14(15-13-8)7-11-5-4-6-12-9(11)2/h4-6H,7H2,1-3H3/q+1 |
| InChIKey | XIDDIOKGZSBLFB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 42.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|