C31H36ClN3O4 — CID 148541106
1-[4-[4-[2-(2-chloro-4,6-dimethoxyphenyl)acetyl]piperazin-1-yl]phenyl]-3-(2,4-dimethylanilino)propan-2-one (PubChem CID 148541106) has the molecular formula C31H36ClN3O4 and a molecular weight of 550.10 g/mol. Its IUPAC name is 1-[4-[4-[2-(2-chloro-4,6-dimethoxyphenyl)acetyl]piperazin-1-yl]phenyl]-3-(2,4-dimethylanilino)propan-2-one.
| Compound Name | 1-[4-[4-[2-(2-chloro-4,6-dimethoxyphenyl)acetyl]piperazin-1-yl]phenyl]-3-(2,4-dimethylanilino)propan-2-one |
|---|---|
| PubChem CID | 148541106 |
| Molecular Formula | C31H36ClN3O4 |
| Molecular Weight | 550.10 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | 1-[4-[4-[2-(2-chloro-4,6-dimethoxyphenyl)acetyl]piperazin-1-yl]phenyl]-3-(2,4-dimethylanilino)propan-2-one |
| SMILES | COc1cc(Cl)c(CC(=O)N2CCN(c3ccc(CC(=O)CNc4ccc(C)cc4C)cc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C31H36ClN3O4/c1-21-5-10-29(22(2)15-21)33-20-25(36)16-23-6-8-24(9-7-23)34-11-13-35(14-12-34)31(37)19-27-28(32)17-26(38-3)18-30(27)39-4/h5-10,15,17-18,33H,11-14,16,19-20H2,1-4H3 |
| InChIKey | MSEJNXZFRVSRBA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.10 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|