C14H34N4S — CID 148550296
N-butyl-N'-[2-(butylamino)ethyl-methylamino]sulfanyl-N'-methylethane-1,2-diamine (PubChem CID 148550296) has the molecular formula C14H34N4S and a molecular weight of 290.52 g/mol. Its IUPAC name is N-butyl-N'-[2-(butylamino)ethyl-methylamino]sulfanyl-N'-methylethane-1,2-diamine.
| Compound Name | N-butyl-N'-[2-(butylamino)ethyl-methylamino]sulfanyl-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 148550296 |
| Molecular Formula | C14H34N4S |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | N-butyl-N'-[2-(butylamino)ethyl-methylamino]sulfanyl-N'-methylethane-1,2-diamine |
| SMILES | CCCCNCCN(C)SN(C)CCNCCCC |
| InChI | InChI=1S/C14H34N4S/c1-5-7-9-15-11-13-17(3)19-18(4)14-12-16-10-8-6-2/h15-16H,5-14H2,1-4H3 |
| InChIKey | QVPDNNOBKZIASS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|