C21H24N2O5 — CID 148572944
(Z)-2-ethoxy-3-[4-[2-(5-ethyl-2-pyridinyl)-2-(hydroxymethylimino)ethoxy]phenyl]prop-2-enoic acid (PubChem CID 148572944) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is (Z)-2-ethoxy-3-[4-[2-(5-ethyl-2-pyridinyl)-2-(hydroxymethylimino)ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | (Z)-2-ethoxy-3-[4-[2-(5-ethyl-2-pyridinyl)-2-(hydroxymethylimino)ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 148572944 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | (Z)-2-ethoxy-3-[4-[2-(5-ethyl-2-pyridinyl)-2-(hydroxymethylimino)ethoxy]phenyl]prop-2-enoic acid |
| SMILES | CCO/C(=C\c1ccc(OCC(=NCO)c2ccc(CC)cn2)cc1)C(=O)O |
| InChI | InChI=1S/C21H24N2O5/c1-3-15-7-10-18(22-12-15)19(23-14-24)13-28-17-8-5-16(6-9-17)11-20(21(25)26)27-4-2/h5-12,24H,3-4,13-14H2,1-2H3,(H,25,26)/b20-11-,23-19? |
| InChIKey | MXFQVGDJQBHINB-CUXDYSPASA-N |
| XLogP | 2.92 |
| TPSA | 101.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|