C11H13F3N2O2 — CID 148586069
(2R)-2-[(3-amino-2-pyridinyl)oxy]-6,6,6-trifluorohexan-3-one (PubChem CID 148586069) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is (2R)-2-[(3-amino-2-pyridinyl)oxy]-6,6,6-trifluorohexan-3-one.
| Compound Name | (2R)-2-[(3-amino-2-pyridinyl)oxy]-6,6,6-trifluorohexan-3-one |
|---|---|
| PubChem CID | 148586069 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | (2R)-2-[(3-amino-2-pyridinyl)oxy]-6,6,6-trifluorohexan-3-one |
| SMILES | C[C@@H](Oc1ncccc1N)C(=O)CCC(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O2/c1-7(9(17)4-5-11(12,13)14)18-10-8(15)3-2-6-16-10/h2-3,6-7H,4-5,15H2,1H3/t7-/m1/s1 |
| InChIKey | MZSJHKXLSBNAKO-SSDOTTSWSA-N |
| XLogP | 2.34 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |