C14H18F3N3O — CID 25148553
(E)-4-[(2-amino-3-pyridinyl)amino]-1,1,1-trifluoro-7-methyloct-3-en-2-one (PubChem CID 25148553) has the molecular formula C14H18F3N3O and a molecular weight of 301.31 g/mol. Its IUPAC name is (E)-4-[(2-amino-3-pyridinyl)amino]-1,1,1-trifluoro-7-methyloct-3-en-2-one.
| Compound Name | (E)-4-[(2-amino-3-pyridinyl)amino]-1,1,1-trifluoro-7-methyloct-3-en-2-one |
|---|---|
| PubChem CID | 25148553 |
| Molecular Formula | C14H18F3N3O |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | (E)-4-[(2-amino-3-pyridinyl)amino]-1,1,1-trifluoro-7-methyloct-3-en-2-one |
| SMILES | CC(C)CC/C(=C\C(=O)C(F)(F)F)Nc1cccnc1N |
| InChI | InChI=1S/C14H18F3N3O/c1-9(2)5-6-10(8-12(21)14(15,16)17)20-11-4-3-7-19-13(11)18/h3-4,7-9,20H,5-6H2,1-2H3,(H2,18,19)/b10-8+ |
| InChIKey | RCXINCPJXUBXNQ-CSKARUKUSA-N |
| XLogP | 3.53 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|