C20H16N4 — CID 148586360
N-methyl-4-naphthalen-2-yl-6-phenyl-1,3,5-triazin-2-amine (PubChem CID 148586360) has the molecular formula C20H16N4 and a molecular weight of 312.38 g/mol. Its IUPAC name is N-methyl-4-naphthalen-2-yl-6-phenyl-1,3,5-triazin-2-amine.
| Compound Name | N-methyl-4-naphthalen-2-yl-6-phenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 148586360 |
| Molecular Formula | C20H16N4 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | N-methyl-4-naphthalen-2-yl-6-phenyl-1,3,5-triazin-2-amine |
| SMILES | CNc1nc(-c2ccccc2)nc(-c2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C20H16N4/c1-21-20-23-18(15-8-3-2-4-9-15)22-19(24-20)17-12-11-14-7-5-6-10-16(14)13-17/h2-13H,1H3,(H,21,22,23,24) |
| InChIKey | MZTSRXAKSROHEP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |