C27H29N5O4S — CID 148586404
ethyl 4-[4-[7-(6-isocyano-5-methyl-3-pyridinyl)-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenoxy]piperidine-1-carboxylate (PubChem CID 148586404) has the molecular formula C27H29N5O4S and a molecular weight of 519.63 g/mol. Its IUPAC name is ethyl 4-[4-[7-(6-isocyano-5-methyl-3-pyridinyl)-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenoxy]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[4-[7-(6-isocyano-5-methyl-3-pyridinyl)-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 148586404 |
| Molecular Formula | C27H29N5O4S |
| Molecular Weight | 519.63 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | ethyl 4-[4-[7-(6-isocyano-5-methyl-3-pyridinyl)-8-oxo-6-sulfanylidene-5,7-diazaspiro[3.4]octan-5-yl]phenoxy]piperidine-1-carboxylate |
| SMILES | [C-]#[N+]c1ncc(N2C(=O)C3(CCC3)N(c3ccc(OC4CCN(C(=O)OCC)CC4)cc3)C2=S)cc1C |
| InChI | InChI=1S/C27H29N5O4S/c1-4-35-26(34)30-14-10-22(11-15-30)36-21-8-6-19(7-9-21)32-25(37)31(24(33)27(32)12-5-13-27)20-16-18(2)23(28-3)29-17-20/h6-9,16-17,22H,4-5,10-15H2,1-2H3 |
| InChIKey | MZTYYMOTLOUXPL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 79.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.63 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|