C25H27F2N3O4 — CID 148591422
1-cyclopentyl-3-(2,6-difluoro-3,5-dimethoxyphenyl)-7-(3-oxopent-4-enyl)-4H-pyrido[4,3-d]pyrimidin-2-one (PubChem CID 148591422) has the molecular formula C25H27F2N3O4 and a molecular weight of 471.50 g/mol. Its IUPAC name is 1-cyclopentyl-3-(2,6-difluoro-3,5-dimethoxyphenyl)-7-(3-oxopent-4-enyl)-4H-pyrido[4,3-d]pyrimidin-2-one.
| Compound Name | 1-cyclopentyl-3-(2,6-difluoro-3,5-dimethoxyphenyl)-7-(3-oxopent-4-enyl)-4H-pyrido[4,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 148591422 |
| Molecular Formula | C25H27F2N3O4 |
| Molecular Weight | 471.50 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 1-cyclopentyl-3-(2,6-difluoro-3,5-dimethoxyphenyl)-7-(3-oxopent-4-enyl)-4H-pyrido[4,3-d]pyrimidin-2-one |
| SMILES | C=CC(=O)CCc1cc2c(cn1)CN(c1c(F)c(OC)cc(OC)c1F)C(=O)N2C1CCCC1 |
| InChI | InChI=1S/C25H27F2N3O4/c1-4-18(31)10-9-16-11-19-15(13-28-16)14-29(25(32)30(19)17-7-5-6-8-17)24-22(26)20(33-2)12-21(34-3)23(24)27/h4,11-13,17H,1,5-10,14H2,2-3H3 |
| InChIKey | NASFDRSJDQKTDE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|