C22H22F2N4O3 — CID 129193168
13-cyclopentyl-11-(2,6-difluoro-3,5-dimethoxyphenyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one (PubChem CID 129193168) has the molecular formula C22H22F2N4O3 and a molecular weight of 428.44 g/mol. Its IUPAC name is 13-cyclopentyl-11-(2,6-difluoro-3,5-dimethoxyphenyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one.
| Compound Name | 13-cyclopentyl-11-(2,6-difluoro-3,5-dimethoxyphenyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
|---|---|
| PubChem CID | 129193168 |
| Molecular Formula | C22H22F2N4O3 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 13-cyclopentyl-11-(2,6-difluoro-3,5-dimethoxyphenyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4[nH]ccc4c3N(C3CCCC3)C2=O)c1F |
| InChI | InChI=1S/C22H22F2N4O3/c1-30-15-9-16(31-2)18(24)20(17(15)23)27-11-12-10-26-21-14(7-8-25-21)19(12)28(22(27)29)13-5-3-4-6-13/h7-10,13H,3-6,11H2,1-2H3,(H,25,26) |
| InChIKey | KEMQFHQCCIVMMM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |