C31H40FN3O3 — CID 148599316
4-fluoro-N-[6-(4-hydroxy-4-methylpentyl)-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]-3H-indol-2-ylidene]benzamide (PubChem CID 148599316) has the molecular formula C31H40FN3O3 and a molecular weight of 521.68 g/mol. Its IUPAC name is 4-fluoro-N-[6-(4-hydroxy-4-methylpentyl)-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]-3H-indol-2-ylidene]benzamide.
| Compound Name | 4-fluoro-N-[6-(4-hydroxy-4-methylpentyl)-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]-3H-indol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 148599316 |
| Molecular Formula | C31H40FN3O3 |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 521.31 |
| IUPAC Name | 4-fluoro-N-[6-(4-hydroxy-4-methylpentyl)-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]-3H-indol-2-ylidene]benzamide |
| SMILES | CC(C)NC(=O)C1CCC(N2/C(=N/C(=O)c3ccc(F)cc3)Cc3ccc(CCCC(C)(C)O)cc32)CC1 |
| InChI | InChI=1S/C31H40FN3O3/c1-20(2)33-29(36)23-11-15-26(16-12-23)35-27-18-21(6-5-17-31(3,4)38)7-8-24(27)19-28(35)34-30(37)22-9-13-25(32)14-10-22/h7-10,13-14,18,20,23,26,38H,5-6,11-12,15-17,19H2,1-4H3,(H,33,36)/b34-28+ |
| InChIKey | NCEYRBGZEZHHJX-CDSHQWRTSA-N |
| XLogP | 5.60 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|