C20H17ClN2O2 — CID 1485997
N,1-dibenzyl-5-chloro-6-oxopyridine-3-carboxamide (PubChem CID 1485997) has the molecular formula C20H17ClN2O2 and a molecular weight of 352.82 g/mol. Its IUPAC name is N,1-dibenzyl-5-chloro-6-oxopyridine-3-carboxamide.
| Compound Name | N,1-dibenzyl-5-chloro-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 1485997 |
| Molecular Formula | C20H17ClN2O2 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N,1-dibenzyl-5-chloro-6-oxopyridine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1cc(Cl)c(=O)n(Cc2ccccc2)c1 |
| InChI | InChI=1S/C20H17ClN2O2/c21-18-11-17(19(24)22-12-15-7-3-1-4-8-15)14-23(20(18)25)13-16-9-5-2-6-10-16/h1-11,14H,12-13H2,(H,22,24) |
| InChIKey | AUHSUPOAHXXDLU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |