C16H14F4N4O2 — CID 148603618
1-[4-(1-fluoroethenyl)-1-[(4-methoxyphenyl)methyl]-3-(trifluoromethyl)pyrazol-5-yl]-2-hydrazinylideneethanone (PubChem CID 148603618) has the molecular formula C16H14F4N4O2 and a molecular weight of 370.31 g/mol. Its IUPAC name is 1-[4-(1-fluoroethenyl)-1-[(4-methoxyphenyl)methyl]-3-(trifluoromethyl)pyrazol-5-yl]-2-hydrazinylideneethanone.
| Compound Name | 1-[4-(1-fluoroethenyl)-1-[(4-methoxyphenyl)methyl]-3-(trifluoromethyl)pyrazol-5-yl]-2-hydrazinylideneethanone |
|---|---|
| PubChem CID | 148603618 |
| Molecular Formula | C16H14F4N4O2 |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 1-[4-(1-fluoroethenyl)-1-[(4-methoxyphenyl)methyl]-3-(trifluoromethyl)pyrazol-5-yl]-2-hydrazinylideneethanone |
| SMILES | C=C(F)c1c(C(F)(F)F)nn(Cc2ccc(OC)cc2)c1C(=O)C=NN |
| InChI | InChI=1S/C16H14F4N4O2/c1-9(17)13-14(12(25)7-22-21)24(23-15(13)16(18,19)20)8-10-3-5-11(26-2)6-4-10/h3-7H,1,8,21H2,2H3 |
| InChIKey | KZZDGOGLGDFGPD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 82.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|