C12H15BrFNO3 — CID 148609218
4-(4-bromo-3-fluorophenyl)-4,4-dimethoxybutanamide (PubChem CID 148609218) has the molecular formula C12H15BrFNO3 and a molecular weight of 320.16 g/mol. Its IUPAC name is 4-(4-bromo-3-fluorophenyl)-4,4-dimethoxybutanamide.
| Compound Name | 4-(4-bromo-3-fluorophenyl)-4,4-dimethoxybutanamide |
|---|---|
| PubChem CID | 148609218 |
| Molecular Formula | C12H15BrFNO3 |
| Molecular Weight | 320.16 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 4-(4-bromo-3-fluorophenyl)-4,4-dimethoxybutanamide |
| SMILES | COC(CCC(N)=O)(OC)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C12H15BrFNO3/c1-17-12(18-2,6-5-11(15)16)8-3-4-9(13)10(14)7-8/h3-4,7H,5-6H2,1-2H3,(H2,15,16) |
| InChIKey | NEALUUCFSMDLJU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.16 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|