C46H37BN2O3 — CID 148616006
2-phenyl-4-(4-phenylphenyl)-6-[6-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-4-yl]pyrimidine (PubChem CID 148616006) has the molecular formula C46H37BN2O3 and a molecular weight of 676.63 g/mol. Its IUPAC name is 2-phenyl-4-(4-phenylphenyl)-6-[6-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-4-yl]pyrimidine.
| Compound Name | 2-phenyl-4-(4-phenylphenyl)-6-[6-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-4-yl]pyrimidine |
|---|---|
| PubChem CID | 148616006 |
| Molecular Formula | C46H37BN2O3 |
| Molecular Weight | 676.63 g/mol |
| Exact Mass | 676.29 |
| IUPAC Name | 2-phenyl-4-(4-phenylphenyl)-6-[6-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-4-yl]pyrimidine |
| SMILES | CC1(C)OB(c2cc(-c3cc(-c4ccc(-c5ccccc5)cc4)nc(-c4ccccc4)n3)c3oc4c(-c5ccccc5)cccc4c3c2)OC1(C)C |
| InChI | InChI=1S/C46H37BN2O3/c1-45(2)46(3,4)52-47(51-45)35-27-38-37-22-14-21-36(32-17-10-6-11-18-32)42(37)50-43(38)39(28-35)41-29-40(48-44(49-41)34-19-12-7-13-20-34)33-25-23-31(24-26-33)30-15-8-5-9-16-30/h5-29H,1-4H3 |
| InChIKey | NFHWGTWAXOJAOZ-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.63 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|