C13H11F3O — CID 148633925
2-[2-[4-(trifluoromethyl)phenyl]ethyl]furan (PubChem CID 148633925) has the molecular formula C13H11F3O and a molecular weight of 240.22 g/mol. Its IUPAC name is 2-[2-[4-(trifluoromethyl)phenyl]ethyl]furan.
| Compound Name | 2-[2-[4-(trifluoromethyl)phenyl]ethyl]furan |
|---|---|
| PubChem CID | 148633925 |
| Molecular Formula | C13H11F3O |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2-[2-[4-(trifluoromethyl)phenyl]ethyl]furan |
| SMILES | FC(F)(F)c1ccc(CCc2ccco2)cc1 |
| InChI | InChI=1S/C13H11F3O/c14-13(15,16)11-6-3-10(4-7-11)5-8-12-2-1-9-17-12/h1-4,6-7,9H,5,8H2 |
| InChIKey | NIRPJZICMZKZNA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |