C25H29N3O5S — CID 148636541
(E)-2-cyano-3-[4-(2-oxononoxy)phenyl]-N-(4-sulfamoylphenyl)prop-2-enamide (PubChem CID 148636541) has the molecular formula C25H29N3O5S and a molecular weight of 483.59 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-(2-oxononoxy)phenyl]-N-(4-sulfamoylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[4-(2-oxononoxy)phenyl]-N-(4-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 148636541 |
| Molecular Formula | C25H29N3O5S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | (E)-2-cyano-3-[4-(2-oxononoxy)phenyl]-N-(4-sulfamoylphenyl)prop-2-enamide |
| SMILES | CCCCCCCC(=O)COc1ccc(/C=C(\C#N)C(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C25H29N3O5S/c1-2-3-4-5-6-7-22(29)18-33-23-12-8-19(9-13-23)16-20(17-26)25(30)28-21-10-14-24(15-11-21)34(27,31)32/h8-16H,2-7,18H2,1H3,(H,28,30)(H2,27,31,32)/b20-16+ |
| InChIKey | NJELVKGESWOAMP-CAPFRKAQSA-N |
| XLogP | 4.19 |
| TPSA | 139.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|