C30H32ClFN8O4 — CID 148643089
2-methoxyethyl 2-[(14S)-14-[[(E)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]acetate (PubChem CID 148643089) has the molecular formula C30H32ClFN8O4 and a molecular weight of 623.09 g/mol. Its IUPAC name is 2-methoxyethyl 2-[(14S)-14-[[(E)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]acetate.
| Compound Name | 2-methoxyethyl 2-[(14S)-14-[[(E)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]acetate |
|---|---|
| PubChem CID | 148643089 |
| Molecular Formula | C30H32ClFN8O4 |
| Molecular Weight | 623.09 g/mol |
| Exact Mass | 622.22 |
| IUPAC Name | 2-methoxyethyl 2-[(14S)-14-[[(E)-3-[3-chloro-2-fluoro-6-(tetrazol-1-yl)phenyl]prop-2-enoyl]amino]-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]acetate |
| SMILES | COCCOC(=O)Cc1ccc2c(c1)NCCCCC[C@H](NC(=O)/C=C/c1c(-n3cnnn3)ccc(Cl)c1F)c1ncc-2[nH]1 |
| InChI | InChI=1S/C30H32ClFN8O4/c1-43-13-14-44-28(42)16-19-6-7-20-24(15-19)33-12-4-2-3-5-23(30-34-17-25(20)37-30)36-27(41)11-8-21-26(40-18-35-38-39-40)10-9-22(31)29(21)32/h6-11,15,17-18,23,33H,2-5,12-14,16H2,1H3,(H,34,37)(H,36,41)/b11-8+/t23-/m0/s1 |
| InChIKey | NKKOCFBCTXWQJB-HDFUYHJRSA-N |
| XLogP | 4.43 |
| TPSA | 148.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.09 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|