C12H14N2O2S — CID 1486442
4-(benzenesulfonylmethyl)-3,5-dimethyl-1H-pyrazole (PubChem CID 1486442) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 4-(benzenesulfonylmethyl)-3,5-dimethyl-1H-pyrazole.
| Compound Name | 4-(benzenesulfonylmethyl)-3,5-dimethyl-1H-pyrazole |
|---|---|
| PubChem CID | 1486442 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 4-(benzenesulfonylmethyl)-3,5-dimethyl-1H-pyrazole |
| SMILES | Cc1n[nH]c(C)c1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H14N2O2S/c1-9-12(10(2)14-13-9)8-17(15,16)11-6-4-3-5-7-11/h3-7H,8H2,1-2H3,(H,13,14) |
| InChIKey | IABQANRJYXLDGH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |