C11H12N2S — CID 703428
3,5-dimethyl-4-phenylsulfanyl-1H-pyrazole (PubChem CID 703428) has the molecular formula C11H12N2S and a molecular weight of 204.30 g/mol. Its IUPAC name is 3,5-dimethyl-4-phenylsulfanyl-1H-pyrazole.
| Compound Name | 3,5-dimethyl-4-phenylsulfanyl-1H-pyrazole |
|---|---|
| PubChem CID | 703428 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 3,5-dimethyl-4-phenylsulfanyl-1H-pyrazole |
| SMILES | Cc1n[nH]c(C)c1Sc1ccccc1 |
| InChI | InChI=1S/C11H12N2S/c1-8-11(9(2)13-12-8)14-10-6-4-3-5-7-10/h3-7H,1-2H3,(H,12,13) |
| InChIKey | APXWHRBKXVTMIZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |