C12H14N2S — CID 746386
3,5-dimethyl-4-(4-methylphenyl)sulfanyl-1H-pyrazole (PubChem CID 746386) has the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 3,5-dimethyl-4-(4-methylphenyl)sulfanyl-1H-pyrazole.
| Compound Name | 3,5-dimethyl-4-(4-methylphenyl)sulfanyl-1H-pyrazole |
|---|---|
| PubChem CID | 746386 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 3,5-dimethyl-4-(4-methylphenyl)sulfanyl-1H-pyrazole |
| SMILES | Cc1ccc(Sc2c(C)n[nH]c2C)cc1 |
| InChI | InChI=1S/C12H14N2S/c1-8-4-6-11(7-5-8)15-12-9(2)13-14-10(12)3/h4-7H,1-3H3,(H,13,14) |
| InChIKey | RVMKFXZYJZRTGS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |