C11H13N3S — CID 703197
2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfanyl]aniline (PubChem CID 703197) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfanyl]aniline.
| Compound Name | 2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfanyl]aniline |
|---|---|
| PubChem CID | 703197 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 2-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfanyl]aniline |
| SMILES | Cc1n[nH]c(C)c1Sc1ccccc1N |
| InChI | InChI=1S/C11H13N3S/c1-7-11(8(2)14-13-7)15-10-6-4-3-5-9(10)12/h3-6H,12H2,1-2H3,(H,13,14) |
| InChIKey | OXZGNCVDJZPDAX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|