C7H11F3OSi — CID 148674502
4-dimethylsilyl-1,1,1-trifluoro-2-methylbut-3-yn-2-ol (PubChem CID 148674502) has the molecular formula C7H11F3OSi and a molecular weight of 196.24 g/mol. Its IUPAC name is 4-dimethylsilyl-1,1,1-trifluoro-2-methylbut-3-yn-2-ol.
| Compound Name | 4-dimethylsilyl-1,1,1-trifluoro-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 148674502 |
| Molecular Formula | C7H11F3OSi |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 4-dimethylsilyl-1,1,1-trifluoro-2-methylbut-3-yn-2-ol |
| SMILES | C[SiH](C)C#CC(C)(O)C(F)(F)F |
| InChI | InChI=1S/C7H11F3OSi/c1-6(11,7(8,9)10)4-5-12(2)3/h11-12H,1-3H3 |
| InChIKey | NQJKDTQXNOPKPW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|