C8H13F3OSi — CID 124635878
(2S)-1,1,1-trifluoro-2-methyl-4-trimethylsilylbut-3-yn-2-ol (PubChem CID 124635878) has the molecular formula C8H13F3OSi and a molecular weight of 210.27 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-2-methyl-4-trimethylsilylbut-3-yn-2-ol.
| Compound Name | (2S)-1,1,1-trifluoro-2-methyl-4-trimethylsilylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 124635878 |
| Molecular Formula | C8H13F3OSi |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | (2S)-1,1,1-trifluoro-2-methyl-4-trimethylsilylbut-3-yn-2-ol |
| SMILES | C[C@](O)(C#C[Si](C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C8H13F3OSi/c1-7(12,8(9,10)11)5-6-13(2,3)4/h12H,1-4H3/t7-/m0/s1 |
| InChIKey | VMUDBYXRQGKKHB-ZETCQYMHSA-N |
| XLogP | 2.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|