C12H19F3OSi2 — CID 15811709
3-(trifluoromethyl)-1,5-bis(trimethylsilyl)penta-1,4-diyn-3-ol (PubChem CID 15811709) has the molecular formula C12H19F3OSi2 and a molecular weight of 292.45 g/mol. Its IUPAC name is 3-(trifluoromethyl)-1,5-bis(trimethylsilyl)penta-1,4-diyn-3-ol.
| Compound Name | 3-(trifluoromethyl)-1,5-bis(trimethylsilyl)penta-1,4-diyn-3-ol |
|---|---|
| PubChem CID | 15811709 |
| Molecular Formula | C12H19F3OSi2 |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 3-(trifluoromethyl)-1,5-bis(trimethylsilyl)penta-1,4-diyn-3-ol |
| SMILES | C[Si](C)(C)C#CC(O)(C#C[Si](C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C12H19F3OSi2/c1-17(2,3)9-7-11(16,12(13,14)15)8-10-18(4,5)6/h16H,1-6H3 |
| InChIKey | JPBRVTSPQGGQGC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|