C15H28F2OSi — CID 15495758
3,3-difluoro-2-methyl-5-tri(propan-2-yl)silylpent-4-yn-2-ol (PubChem CID 15495758) has the molecular formula C15H28F2OSi and a molecular weight of 290.47 g/mol. Its IUPAC name is 3,3-difluoro-2-methyl-5-tri(propan-2-yl)silylpent-4-yn-2-ol.
| Compound Name | 3,3-difluoro-2-methyl-5-tri(propan-2-yl)silylpent-4-yn-2-ol |
|---|---|
| PubChem CID | 15495758 |
| Molecular Formula | C15H28F2OSi |
| Molecular Weight | 290.47 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 3,3-difluoro-2-methyl-5-tri(propan-2-yl)silylpent-4-yn-2-ol |
| SMILES | CC(C)[Si](C#CC(F)(F)C(C)(C)O)(C(C)C)C(C)C |
| InChI | InChI=1S/C15H28F2OSi/c1-11(2)19(12(3)4,13(5)6)10-9-15(16,17)14(7,8)18/h11-13,18H,1-8H3 |
| InChIKey | DBQNDRFJGUUOFV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|