C16H30F2OSi — CID 15495759
4,4-difluoro-3-methyl-6-tri(propan-2-yl)silylhex-5-yn-3-ol (PubChem CID 15495759) has the molecular formula C16H30F2OSi and a molecular weight of 304.50 g/mol. Its IUPAC name is 4,4-difluoro-3-methyl-6-tri(propan-2-yl)silylhex-5-yn-3-ol.
| Compound Name | 4,4-difluoro-3-methyl-6-tri(propan-2-yl)silylhex-5-yn-3-ol |
|---|---|
| PubChem CID | 15495759 |
| Molecular Formula | C16H30F2OSi |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 4,4-difluoro-3-methyl-6-tri(propan-2-yl)silylhex-5-yn-3-ol |
| SMILES | CCC(C)(O)C(F)(F)C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H30F2OSi/c1-9-15(8,19)16(17,18)10-11-20(12(2)3,13(4)5)14(6)7/h12-14,19H,9H2,1-8H3 |
| InChIKey | UHVHIWLBJJVVID-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|