C10H20INO4 — CID 148676433
N-iodo-2-[4-(3-methoxypropoxy)butoxy]acetamide (PubChem CID 148676433) has the molecular formula C10H20INO4 and a molecular weight of 345.18 g/mol. Its IUPAC name is N-iodo-2-[4-(3-methoxypropoxy)butoxy]acetamide.
| Compound Name | N-iodo-2-[4-(3-methoxypropoxy)butoxy]acetamide |
|---|---|
| PubChem CID | 148676433 |
| Molecular Formula | C10H20INO4 |
| Molecular Weight | 345.18 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | N-iodo-2-[4-(3-methoxypropoxy)butoxy]acetamide |
| SMILES | COCCCOCCCCOCC(=O)NI |
| InChI | InChI=1S/C10H20INO4/c1-14-5-4-8-15-6-2-3-7-16-9-10(13)12-11/h2-9H2,1H3,(H,12,13) |
| InChIKey | NQSVYFGJTFNZQE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.18 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|